C14H23NO5 — CID 124515314
2-[(2R)-4-[3-[(2S)-oxan-2-yl]propanoyl]morpholin-2-yl]acetic acid (PubChem CID 124515314) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-[(2R)-4-[3-[(2S)-oxan-2-yl]propanoyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[(2R)-4-[3-[(2S)-oxan-2-yl]propanoyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 124515314 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2-[(2R)-4-[3-[(2S)-oxan-2-yl]propanoyl]morpholin-2-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1CN(C(=O)CC[C@@H]2CCCCO2)CCO1 |
| InChI | InChI=1S/C14H23NO5/c16-13(5-4-11-3-1-2-7-19-11)15-6-8-20-12(10-15)9-14(17)18/h11-12H,1-10H2,(H,17,18)/t11-,12+/m0/s1 |
| InChIKey | YMIKRTPLTKVHGP-NWDGAFQWSA-N |
| XLogP | 1.04 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |