C12H19NO5 — CID 124515362
2-[(2S)-4-[(3S)-oxane-3-carbonyl]morpholin-2-yl]acetic acid (PubChem CID 124515362) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-[(2S)-4-[(3S)-oxane-3-carbonyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[(2S)-4-[(3S)-oxane-3-carbonyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 124515362 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 2-[(2S)-4-[(3S)-oxane-3-carbonyl]morpholin-2-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1CN(C(=O)[C@H]2CCCOC2)CCO1 |
| InChI | InChI=1S/C12H19NO5/c14-11(15)6-10-7-13(3-5-18-10)12(16)9-2-1-4-17-8-9/h9-10H,1-8H2,(H,14,15)/t9-,10-/m0/s1 |
| InChIKey | VHKZSVTURRZWHJ-UWVGGRQHSA-N |
| XLogP | 0.12 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |