C14H20N2O — CID 124515685
3-methyl-N-[(2S,3S)-2-methylpiperidin-3-yl]benzamide (PubChem CID 124515685) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-methyl-N-[(2S,3S)-2-methylpiperidin-3-yl]benzamide.
| Compound Name | 3-methyl-N-[(2S,3S)-2-methylpiperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 124515685 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 3-methyl-N-[(2S,3S)-2-methylpiperidin-3-yl]benzamide |
| SMILES | Cc1cccc(C(=O)N[C@H]2CCCN[C@H]2C)c1 |
| InChI | InChI=1S/C14H20N2O/c1-10-5-3-6-12(9-10)14(17)16-13-7-4-8-15-11(13)2/h3,5-6,9,11,13,15H,4,7-8H2,1-2H3,(H,16,17)/t11-,13-/m0/s1 |
| InChIKey | QBNLHOANVIRYRH-AAEUAGOBSA-N |
| XLogP | 1.87 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |