C14H17ClN4S — CID 124516668
(3R)-3-(4-chlorophenyl)-4-[(3-methyltriazol-4-yl)methyl]thiomorpholine (PubChem CID 124516668) has the molecular formula C14H17ClN4S and a molecular weight of 308.84 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-4-[(3-methyltriazol-4-yl)methyl]thiomorpholine.
| Compound Name | (3R)-3-(4-chlorophenyl)-4-[(3-methyltriazol-4-yl)methyl]thiomorpholine |
|---|---|
| PubChem CID | 124516668 |
| Molecular Formula | C14H17ClN4S |
| Molecular Weight | 308.84 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-4-[(3-methyltriazol-4-yl)methyl]thiomorpholine |
| SMILES | Cn1nncc1CN1CCSC[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H17ClN4S/c1-18-13(8-16-17-18)9-19-6-7-20-10-14(19)11-2-4-12(15)5-3-11/h2-5,8,14H,6-7,9-10H2,1H3/t14-/m0/s1 |
| InChIKey | HDILULZSTWIFHP-AWEZNQCLSA-N |
| XLogP | 2.76 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.84 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |