C13H17FN2O — CID 124517231
[(2R)-2-(aminomethyl)pyrrolidin-1-yl]-(2-fluoro-4-methylphenyl)methanone (PubChem CID 124517231) has the molecular formula C13H17FN2O and a molecular weight of 236.29 g/mol. Its IUPAC name is [(2R)-2-(aminomethyl)pyrrolidin-1-yl]-(2-fluoro-4-methylphenyl)methanone.
| Compound Name | [(2R)-2-(aminomethyl)pyrrolidin-1-yl]-(2-fluoro-4-methylphenyl)methanone |
|---|---|
| PubChem CID | 124517231 |
| Molecular Formula | C13H17FN2O |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | [(2R)-2-(aminomethyl)pyrrolidin-1-yl]-(2-fluoro-4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCC[C@@H]2CN)c(F)c1 |
| InChI | InChI=1S/C13H17FN2O/c1-9-4-5-11(12(14)7-9)13(17)16-6-2-3-10(16)8-15/h4-5,7,10H,2-3,6,8,15H2,1H3/t10-/m1/s1 |
| InChIKey | SKKPYCZPKPUDBE-SNVBAGLBSA-N |
| XLogP | 1.70 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |