About 3H-pyrrole-4-carboxamide
3H-pyrrole-4-carboxamide (PubChem CID 124517663) has the molecular formula C5H6N2O
and a molecular weight of 110.12 g/mol. Its IUPAC name is 3H-pyrrole-4-carboxamide.
Molecular Properties
| Compound Name | 3H-pyrrole-4-carboxamide |
| PubChem CID | 124517663 |
| Molecular Formula | C5H6N2O |
| Molecular Weight | 110.12 g/mol |
| Exact Mass | 110.05 |
| IUPAC Name | 3H-pyrrole-4-carboxamide |
| SMILES | NC(=O)C1=CN=CC1 |
| InChI | InChI=1S/C5H6N2O/c6-5(8)4-1-2-7-3-4/h2-3H,1H2,(H2,6,8) |
| InChIKey | POGDTRFNFFWDJN-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.12 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3H-pyrrole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-pyrrole-4-carboxamide?
The IUPAC name of 3H-pyrrole-4-carboxamide (CID 124517663) is 3H-pyrrole-4-carboxamide.
What is the SMILES notation for 3H-pyrrole-4-carboxamide?
The canonical SMILES for 3H-pyrrole-4-carboxamide is NC(=O)C1=CN=CC1.
What is the InChIKey of 3H-pyrrole-4-carboxamide?
The InChIKey is POGDTRFNFFWDJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O/c6-5(8)4-1-2-7-3-4/h2-3H,1H2,(H2,6,8).
What are the key properties of 3H-pyrrole-4-carboxamide?
3H-pyrrole-4-carboxamide has a molecular weight of 110.12 g/mol, XLogP of -0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-pyrrole-4-carboxamide is sourced from PubChem (CID 124517663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).