About 2H-indole-3-carboxamide
2H-indole-3-carboxamide (PubChem CID 124518031) has the molecular formula C9H8N2O
and a molecular weight of 160.18 g/mol. Its IUPAC name is 2H-indole-3-carboxamide.
Molecular Properties
| Compound Name | 2H-indole-3-carboxamide |
| PubChem CID | 124518031 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 2H-indole-3-carboxamide |
| SMILES | NC(=O)C1=c2ccccc2=NC1 |
| InChI | InChI=1S/C9H8N2O/c10-9(12)7-5-11-8-4-2-1-3-6(7)8/h1-4H,5H2,(H2,10,12) |
| InChIKey | YQWBUIHLQWTMSR-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-indole-3-carboxamide?
The IUPAC name of 2H-indole-3-carboxamide (CID 124518031) is 2H-indole-3-carboxamide.
What is the SMILES notation for 2H-indole-3-carboxamide?
The canonical SMILES for 2H-indole-3-carboxamide is NC(=O)C1=c2ccccc2=NC1.
What is the InChIKey of 2H-indole-3-carboxamide?
The InChIKey is YQWBUIHLQWTMSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O/c10-9(12)7-5-11-8-4-2-1-3-6(7)8/h1-4H,5H2,(H2,10,12).
What are the key properties of 2H-indole-3-carboxamide?
2H-indole-3-carboxamide has a molecular weight of 160.18 g/mol, XLogP of -1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-indole-3-carboxamide is sourced from PubChem (CID 124518031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).