C24H32O6 — CID 124519234
[(2R,4R,8R,9S,13R)-2-acetyloxy-5,5,9-trimethyl-14-methylidene-10,15-dioxo-8-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] acetate (PubChem CID 124519234) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is [(2R,4R,8R,9S,13R)-2-acetyloxy-5,5,9-trimethyl-14-methylidene-10,15-dioxo-8-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] acetate.
| Compound Name | [(2R,4R,8R,9S,13R)-2-acetyloxy-5,5,9-trimethyl-14-methylidene-10,15-dioxo-8-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] acetate |
|---|---|
| PubChem CID | 124519234 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [(2R,4R,8R,9S,13R)-2-acetyloxy-5,5,9-trimethyl-14-methylidene-10,15-dioxo-8-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] acetate |
| SMILES | C=C1C(=O)C2=C[C@H]1CCC(=O)[C@@]1(C)[C@H](C[C@H]2OC(C)=O)C(C)(C)CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H32O6/c1-13-16-7-8-20(27)24(6)19(23(4,5)10-9-21(24)30-15(3)26)12-18(29-14(2)25)17(11-16)22(13)28/h11,16,18-19,21H,1,7-10,12H2,2-6H3/t16-,18-,19-,21-,24-/m1/s1 |
| InChIKey | FJZYKHJRASVVMY-KXWXAMNASA-N |
| XLogP | 3.73 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|