C16H30N2O4S — CID 124519797
(4aR,8aS)-4a-(cyclobutylmethoxymethyl)-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine-6-sulfonamide (PubChem CID 124519797) has the molecular formula C16H30N2O4S and a molecular weight of 346.49 g/mol. Its IUPAC name is (4aR,8aS)-4a-(cyclobutylmethoxymethyl)-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine-6-sulfonamide.
| Compound Name | (4aR,8aS)-4a-(cyclobutylmethoxymethyl)-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine-6-sulfonamide |
|---|---|
| PubChem CID | 124519797 |
| Molecular Formula | C16H30N2O4S |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (4aR,8aS)-4a-(cyclobutylmethoxymethyl)-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine-6-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CC[C@@H]2OCCC[C@]2(COCC2CCC2)C1 |
| InChI | InChI=1S/C16H30N2O4S/c1-17(2)23(19,20)18-9-7-15-16(12-18,8-4-10-22-15)13-21-11-14-5-3-6-14/h14-15H,3-13H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | XGVNUBWUTUTJKW-JKSUJKDBSA-N |
| XLogP | 1.48 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |