C16H20N4O2S — CID 124520231
(4aR,7S,7aR)-7-(pyrimidin-2-yloxymethyl)-4-(1,3-thiazol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 124520231) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is (4aR,7S,7aR)-7-(pyrimidin-2-yloxymethyl)-4-(1,3-thiazol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | (4aR,7S,7aR)-7-(pyrimidin-2-yloxymethyl)-4-(1,3-thiazol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 124520231 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (4aR,7S,7aR)-7-(pyrimidin-2-yloxymethyl)-4-(1,3-thiazol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | c1cnc(OC[C@@H]2CC[C@@H]3[C@@H]2OCCN3Cc2nccs2)nc1 |
| InChI | InChI=1S/C16H20N4O2S/c1-4-18-16(19-5-1)22-11-12-2-3-13-15(12)21-8-7-20(13)10-14-17-6-9-23-14/h1,4-6,9,12-13,15H,2-3,7-8,10-11H2/t12-,13+,15+/m0/s1 |
| InChIKey | ZDJMKGOAQFNDOR-GZBFAFLISA-N |
| XLogP | 1.99 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |