C16H23N3O3 — CID 124520570
(3S,5S)-7-(oxan-4-yl)-3-pyrimidin-2-yloxy-1-oxa-7-azaspiro[4.4]nonane (PubChem CID 124520570) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is (3S,5S)-7-(oxan-4-yl)-3-pyrimidin-2-yloxy-1-oxa-7-azaspiro[4.4]nonane.
| Compound Name | (3S,5S)-7-(oxan-4-yl)-3-pyrimidin-2-yloxy-1-oxa-7-azaspiro[4.4]nonane |
|---|---|
| PubChem CID | 124520570 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (3S,5S)-7-(oxan-4-yl)-3-pyrimidin-2-yloxy-1-oxa-7-azaspiro[4.4]nonane |
| SMILES | c1cnc(O[C@@H]2CO[C@@]3(CCN(C4CCOCC4)C3)C2)nc1 |
| InChI | InChI=1S/C16H23N3O3/c1-5-17-15(18-6-1)22-14-10-16(21-11-14)4-7-19(12-16)13-2-8-20-9-3-13/h1,5-6,13-14H,2-4,7-12H2/t14-,16-/m0/s1 |
| InChIKey | ZHMRKPPWRDNKIW-HOCLYGCPSA-N |
| XLogP | 1.27 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |