About (3R,5S)-N,N-dimethyl-9-(5-methylpyrimidin-2-yl)-2-oxa-9-azaspiro[4.5]decane-3-carboxamide
(3R,5S)-N,N-dimethyl-9-(5-methylpyrimidin-2-yl)-2-oxa-9-azaspiro[4.5]decane-3-carboxamide (PubChem CID 124521194) has the molecular formula C16H24N4O2
and a molecular weight of 304.39 g/mol. Its IUPAC name is (3R,5S)-N,N-dimethyl-9-(5-methylpyrimidin-2-yl)-2-oxa-9-azaspiro[4.5]decane-3-carboxamide.
Molecular Properties
| Compound Name | (3R,5S)-N,N-dimethyl-9-(5-methylpyrimidin-2-yl)-2-oxa-9-azaspiro[4.5]decane-3-carboxamide |
| PubChem CID | 124521194 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (3R,5S)-N,N-dimethyl-9-(5-methylpyrimidin-2-yl)-2-oxa-9-azaspiro[4.5]decane-3-carboxamide |
| SMILES | Cc1cnc(N2CCC[C@@]3(CO[C@@H](C(=O)N(C)C)C3)C2)nc1 |
| InChI | InChI=1S/C16H24N4O2/c1-12-8-17-15(18-9-12)20-6-4-5-16(10-20)7-13(22-11-16)14(21)19(2)3/h8-9,13H,4-7,10-11H2,1-3H3/t13-,16+/m1/s1 |
| InChIKey | CKMMCRFKHZFKJD-CJNGLKHVSA-N |
| XLogP | 1.25 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R,5S)-N,N-dimethyl-9-(5-methylpyrimidin-2-yl)-2-oxa-9-azaspiro[4.5]decane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-N,N-dimethyl-9-(5-methylpyrimidin-2-yl)-2-oxa-9-azaspiro[4.5]decane-3-carboxamide?
The IUPAC name of (3R,5S)-N,N-dimethyl-9-(5-methylpyrimidin-2-yl)-2-oxa-9-azaspiro[4.5]decane-3-carboxamide (CID 124521194) is (3R,5S)-N,N-dimethyl-9-(5-methylpyrimidin-2-yl)-2-oxa-9-azaspiro[4.5]decane-3-carboxamide.
What is the SMILES notation for (3R,5S)-N,N-dimethyl-9-(5-methylpyrimidin-2-yl)-2-oxa-9-azaspiro[4.5]decane-3-carboxamide?
The canonical SMILES for (3R,5S)-N,N-dimethyl-9-(5-methylpyrimidin-2-yl)-2-oxa-9-azaspiro[4.5]decane-3-carboxamide is Cc1cnc(N2CCC[C@@]3(CO[C@@H](C(=O)N(C)C)C3)C2)nc1.
What is the InChIKey of (3R,5S)-N,N-dimethyl-9-(5-methylpyrimidin-2-yl)-2-oxa-9-azaspiro[4.5]decane-3-carboxamide?
The InChIKey is CKMMCRFKHZFKJD-CJNGLKHVSA-N. The full InChI is InChI=1S/C16H24N4O2/c1-12-8-17-15(18-9-12)20-6-4-5-16(10-20)7-13(22-11-16)14(21)19(2)3/h8-9,13H,4-7,10-11H2,1-3H3/t13-,16+/m1/s1.
What are the key properties of (3R,5S)-N,N-dimethyl-9-(5-methylpyrimidin-2-yl)-2-oxa-9-azaspiro[4.5]decane-3-carboxamide?
(3R,5S)-N,N-dimethyl-9-(5-methylpyrimidin-2-yl)-2-oxa-9-azaspiro[4.5]decane-3-carboxamide has a molecular weight of 304.39 g/mol, XLogP of 1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-N,N-dimethyl-9-(5-methylpyrimidin-2-yl)-2-oxa-9-azaspiro[4.5]decane-3-carboxamide is sourced from PubChem (CID 124521194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).