C14H22N4O3S — CID 124521928
(3S,5R)-9-ethylsulfonyl-N-pyrazin-2-yl-1-oxa-9-azaspiro[4.5]decan-3-amine (PubChem CID 124521928) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is (3S,5R)-9-ethylsulfonyl-N-pyrazin-2-yl-1-oxa-9-azaspiro[4.5]decan-3-amine.
| Compound Name | (3S,5R)-9-ethylsulfonyl-N-pyrazin-2-yl-1-oxa-9-azaspiro[4.5]decan-3-amine |
|---|---|
| PubChem CID | 124521928 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (3S,5R)-9-ethylsulfonyl-N-pyrazin-2-yl-1-oxa-9-azaspiro[4.5]decan-3-amine |
| SMILES | CCS(=O)(=O)N1CCC[C@@]2(C[C@H](Nc3cnccn3)CO2)C1 |
| InChI | InChI=1S/C14H22N4O3S/c1-2-22(19,20)18-7-3-4-14(11-18)8-12(10-21-14)17-13-9-15-5-6-16-13/h5-6,9,12H,2-4,7-8,10-11H2,1H3,(H,16,17)/t12-,14+/m0/s1 |
| InChIKey | NHAUQZJMCICFEG-GXTWGEPZSA-N |
| XLogP | 0.86 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |