About bis[[(2R)-2,3-dibromopropyl]sulfanyl]methylidenecyanamide
bis[[(2R)-2,3-dibromopropyl]sulfanyl]methylidenecyanamide (PubChem CID 124524366) has the molecular formula C8H10Br4N2S2
and a molecular weight of 517.93 g/mol. Its IUPAC name is bis[[(2R)-2,3-dibromopropyl]sulfanyl]methylidenecyanamide.
Molecular Properties
| Compound Name | bis[[(2R)-2,3-dibromopropyl]sulfanyl]methylidenecyanamide |
| PubChem CID | 124524366 |
| Molecular Formula | C8H10Br4N2S2 |
| Molecular Weight | 517.93 g/mol |
| Exact Mass | 513.70 |
| IUPAC Name | bis[[(2R)-2,3-dibromopropyl]sulfanyl]methylidenecyanamide |
| SMILES | N#CN=C(SC[C@@H](Br)CBr)SC[C@@H](Br)CBr |
| InChI | InChI=1S/C8H10Br4N2S2/c9-1-6(11)3-15-8(14-5-13)16-4-7(12)2-10/h6-7H,1-4H2/t6-,7-/m0/s1 |
| InChIKey | LIHVYIJZAPOEDI-BQBZGAKWSA-N |
| XLogP | 4.61 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 517.93 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze bis[[(2R)-2,3-dibromopropyl]sulfanyl]methylidenecyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[[(2R)-2,3-dibromopropyl]sulfanyl]methylidenecyanamide?
The IUPAC name of bis[[(2R)-2,3-dibromopropyl]sulfanyl]methylidenecyanamide (CID 124524366) is bis[[(2R)-2,3-dibromopropyl]sulfanyl]methylidenecyanamide.
What is the SMILES notation for bis[[(2R)-2,3-dibromopropyl]sulfanyl]methylidenecyanamide?
The canonical SMILES for bis[[(2R)-2,3-dibromopropyl]sulfanyl]methylidenecyanamide is N#CN=C(SC[C@@H](Br)CBr)SC[C@@H](Br)CBr.
What is the InChIKey of bis[[(2R)-2,3-dibromopropyl]sulfanyl]methylidenecyanamide?
The InChIKey is LIHVYIJZAPOEDI-BQBZGAKWSA-N. The full InChI is InChI=1S/C8H10Br4N2S2/c9-1-6(11)3-15-8(14-5-13)16-4-7(12)2-10/h6-7H,1-4H2/t6-,7-/m0/s1.
What are the key properties of bis[[(2R)-2,3-dibromopropyl]sulfanyl]methylidenecyanamide?
bis[[(2R)-2,3-dibromopropyl]sulfanyl]methylidenecyanamide has a molecular weight of 517.93 g/mol, XLogP of 4.61, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis[[(2R)-2,3-dibromopropyl]sulfanyl]methylidenecyanamide is sourced from PubChem (CID 124524366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).