C11H16O — CID 124525528
(1S,4R,6S,7S)-tricyclo[5.3.1.02,6]undec-2-en-4-ol (PubChem CID 124525528) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (1S,4R,6S,7S)-tricyclo[5.3.1.02,6]undec-2-en-4-ol.
| Compound Name | (1S,4R,6S,7S)-tricyclo[5.3.1.02,6]undec-2-en-4-ol |
|---|---|
| PubChem CID | 124525528 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (1S,4R,6S,7S)-tricyclo[5.3.1.02,6]undec-2-en-4-ol |
| SMILES | O[C@H]1C=C2[C@H]3CCC[C@@H](C3)[C@@H]2C1 |
| InChI | InChI=1S/C11H16O/c12-9-5-10-7-2-1-3-8(4-7)11(10)6-9/h5,7-9,11-12H,1-4,6H2/t7-,8-,9-,11-/m0/s1 |
| InChIKey | GPIVXAKVGUQXEF-KBIXCLLPSA-N |
| XLogP | 2.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|