C9H13ClO — CID 124526975
2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride (PubChem CID 124526975) has the molecular formula C9H13ClO and a molecular weight of 172.65 g/mol. Its IUPAC name is 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride.
| Compound Name | 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride |
|---|---|
| PubChem CID | 124526975 |
| Molecular Formula | C9H13ClO |
| Molecular Weight | 172.65 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride |
| SMILES | O=C(Cl)C[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C9H13ClO/c10-9(11)5-8-4-6-1-2-7(8)3-6/h6-8H,1-5H2/t6-,7-,8+/m0/s1 |
| InChIKey | SGEBCUSJUMCJGH-BIIVOSGPSA-N |
| XLogP | 2.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.65 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|