2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride

C9H13ClO — CID 124526975

IUPAC2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride
SMILESO=C(Cl)C[C@H]1C[C@H]2CC[C@H]1C2
InChIInChI=1S/C9H13ClO/c10-9(11)5-8-4-6-1-2-7(8)3-6/h6-8H,1-5H2/t6-,7-,8+/m0/s1
InChIKeySGEBCUSJUMCJGH-BIIVOSGPSA-N
MW172.65 g/mol
LogP2.58
Rot. Bonds2

About 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride

2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride (PubChem CID 124526975) has the molecular formula C9H13ClO and a molecular weight of 172.65 g/mol. Its IUPAC name is 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride.

Molecular Properties

Compound Name2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride
PubChem CID124526975
Molecular FormulaC9H13ClO
Molecular Weight172.65 g/mol
Exact Mass172.07
IUPAC Name2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride
SMILESO=C(Cl)C[C@H]1C[C@H]2CC[C@H]1C2
InChIInChI=1S/C9H13ClO/c10-9(11)5-8-4-6-1-2-7(8)3-6/h6-8H,1-5H2/t6-,7-,8+/m0/s1
InChIKeySGEBCUSJUMCJGH-BIIVOSGPSA-N
XLogP2.58
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.65
LogP ≤ 52.58
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride?
The IUPAC name of 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride (CID 124526975) is 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride.
What is the SMILES notation for 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride?
The canonical SMILES for 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride is O=C(Cl)C[C@H]1C[C@H]2CC[C@H]1C2.
What is the InChIKey of 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride?
The InChIKey is SGEBCUSJUMCJGH-BIIVOSGPSA-N. The full InChI is InChI=1S/C9H13ClO/c10-9(11)5-8-4-6-1-2-7(8)3-6/h6-8H,1-5H2/t6-,7-,8+/m0/s1.
What are the key properties of 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride?
2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride has a molecular weight of 172.65 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl chloride is sourced from PubChem (CID 124526975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).