About (2S)-2-chloro-4H-1,3,2λ5-benzodioxaphosphinine 2-oxide
(2S)-2-chloro-4H-1,3,2λ5-benzodioxaphosphinine 2-oxide (PubChem CID 124526976) has the molecular formula C7H6ClO3P
and a molecular weight of 204.55 g/mol. Its IUPAC name is (2S)-2-chloro-4H-1,3,2λ5-benzodioxaphosphinine 2-oxide.
Molecular Properties
| Compound Name | (2S)-2-chloro-4H-1,3,2λ5-benzodioxaphosphinine 2-oxide |
| PubChem CID | 124526976 |
| Molecular Formula | C7H6ClO3P |
| Molecular Weight | 204.55 g/mol |
| Exact Mass | 203.97 |
| IUPAC Name | (2S)-2-chloro-4H-1,3,2λ5-benzodioxaphosphinine 2-oxide |
| SMILES | O=[P@]1(Cl)OCc2ccccc2O1 |
| InChI | InChI=1S/C7H6ClO3P/c8-12(9)10-5-6-3-1-2-4-7(6)11-12/h1-4H,5H2/t12-/m1/s1 |
| InChIKey | VDBAMVKTDUCLPZ-GFCCVEGCSA-N |
| XLogP | 2.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-chloro-4H-1,3,2λ5-benzodioxaphosphinine 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-chloro-4H-1,3,2λ5-benzodioxaphosphinine 2-oxide?
The IUPAC name of (2S)-2-chloro-4H-1,3,2λ5-benzodioxaphosphinine 2-oxide (CID 124526976) is (2S)-2-chloro-4H-1,3,2λ5-benzodioxaphosphinine 2-oxide.
What is the SMILES notation for (2S)-2-chloro-4H-1,3,2λ5-benzodioxaphosphinine 2-oxide?
The canonical SMILES for (2S)-2-chloro-4H-1,3,2λ5-benzodioxaphosphinine 2-oxide is O=[P@]1(Cl)OCc2ccccc2O1.
What is the InChIKey of (2S)-2-chloro-4H-1,3,2λ5-benzodioxaphosphinine 2-oxide?
The InChIKey is VDBAMVKTDUCLPZ-GFCCVEGCSA-N. The full InChI is InChI=1S/C7H6ClO3P/c8-12(9)10-5-6-3-1-2-4-7(6)11-12/h1-4H,5H2/t12-/m1/s1.
What are the key properties of (2S)-2-chloro-4H-1,3,2λ5-benzodioxaphosphinine 2-oxide?
(2S)-2-chloro-4H-1,3,2λ5-benzodioxaphosphinine 2-oxide has a molecular weight of 204.55 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-chloro-4H-1,3,2λ5-benzodioxaphosphinine 2-oxide is sourced from PubChem (CID 124526976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).