C14H16N2O2S — CID 124527575
N-[(E)-[(1R,2R,4S,5S)-6-tricyclo[3.2.1.02,4]octanylidene]amino]benzenesulfonamide (PubChem CID 124527575) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is N-[(E)-[(1R,2R,4S,5S)-6-tricyclo[3.2.1.02,4]octanylidene]amino]benzenesulfonamide.
| Compound Name | N-[(E)-[(1R,2R,4S,5S)-6-tricyclo[3.2.1.02,4]octanylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 124527575 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | N-[(E)-[(1R,2R,4S,5S)-6-tricyclo[3.2.1.02,4]octanylidene]amino]benzenesulfonamide |
| SMILES | O=S(=O)(N/N=C1\C[C@H]2C[C@H]1[C@H]1C[C@H]21)c1ccccc1 |
| InChI | InChI=1S/C14H16N2O2S/c17-19(18,10-4-2-1-3-5-10)16-15-14-7-9-6-13(14)12-8-11(9)12/h1-5,9,11-13,16H,6-8H2/b15-14+/t9-,11-,12+,13+/m1/s1 |
| InChIKey | QFCWVCOGRCWGAS-SXEPSDDZSA-N |
| XLogP | 2.00 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|