C25H18Br2N2O3S — CID 124529900
5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-1,3-bis(4-methylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 124529900) has the molecular formula C25H18Br2N2O3S and a molecular weight of 586.31 g/mol. Its IUPAC name is 5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-1,3-bis(4-methylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-1,3-bis(4-methylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 124529900 |
| Molecular Formula | C25H18Br2N2O3S |
| Molecular Weight | 586.31 g/mol |
| Exact Mass | 583.94 |
| IUPAC Name | 5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-1,3-bis(4-methylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1ccc(N2C(=O)C(=Cc3cc(Br)cc(Br)c3O)C(=O)N(c3ccc(C)cc3)C2=S)cc1 |
| InChI | InChI=1S/C25H18Br2N2O3S/c1-14-3-7-18(8-4-14)28-23(31)20(12-16-11-17(26)13-21(27)22(16)30)24(32)29(25(28)33)19-9-5-15(2)6-10-19/h3-13,30H,1-2H3 |
| InChIKey | ZIYUPWVDSCANEQ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.31 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|