C23H23Br2N3O2 — CID 124531905
3,5-dibromo-N-[(Z)-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 124531905) has the molecular formula C23H23Br2N3O2 and a molecular weight of 533.26 g/mol. Its IUPAC name is 3,5-dibromo-N-[(Z)-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3,5-dibromo-N-[(Z)-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 124531905 |
| Molecular Formula | C23H23Br2N3O2 |
| Molecular Weight | 533.26 g/mol |
| Exact Mass | 531.02 |
| IUPAC Name | 3,5-dibromo-N-[(Z)-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | CCc1cccc(C)c1-n1c(C)cc(/C=N\NC(=O)c2cc(Br)c(O)c(Br)c2)c1C |
| InChI | InChI=1S/C23H23Br2N3O2/c1-5-16-8-6-7-13(2)21(16)28-14(3)9-18(15(28)4)12-26-27-23(30)17-10-19(24)22(29)20(25)11-17/h6-12,29H,5H2,1-4H3,(H,27,30)/b26-12- |
| InChIKey | SGZVVCJDUPYRQJ-ZRGSRPPYSA-N |
| XLogP | 5.96 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.26 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|