C18H18N4O3S — CID 124534377
(E)-2-cyano-3-[(5R)-1-(3,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]-N,N-dimethylprop-2-enamide (PubChem CID 124534377) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is (E)-2-cyano-3-[(5R)-1-(3,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]-N,N-dimethylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-[(5R)-1-(3,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 124534377 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (E)-2-cyano-3-[(5R)-1-(3,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]-N,N-dimethylprop-2-enamide |
| SMILES | Cc1ccc(N2C(=O)[C@H](/C=C(\C#N)C(=O)N(C)C)C(=O)NC2=S)cc1C |
| InChI | InChI=1S/C18H18N4O3S/c1-10-5-6-13(7-11(10)2)22-17(25)14(15(23)20-18(22)26)8-12(9-19)16(24)21(3)4/h5-8,14H,1-4H3,(H,20,23,26)/b12-8+/t14-/m1/s1 |
| InChIKey | SBEKDKNSGYKBPS-CEFACKQISA-N |
| XLogP | 1.21 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|