C24H20N2O4S — CID 124536223
10,10-dioxo-3-[(2S,4S)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-diene-7-carbonyl]thioxanthen-9-one (PubChem CID 124536223) has the molecular formula C24H20N2O4S and a molecular weight of 432.50 g/mol. Its IUPAC name is 10,10-dioxo-3-[(2S,4S)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-diene-7-carbonyl]thioxanthen-9-one.
| Compound Name | 10,10-dioxo-3-[(2S,4S)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-diene-7-carbonyl]thioxanthen-9-one |
|---|---|
| PubChem CID | 124536223 |
| Molecular Formula | C24H20N2O4S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 10,10-dioxo-3-[(2S,4S)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-diene-7-carbonyl]thioxanthen-9-one |
| SMILES | Cc1nn(C(=O)c2ccc3c(c2)S(=O)(=O)c2ccccc2C3=O)c2c1[C@H]1[C@H](C2)C1(C)C |
| InChI | InChI=1S/C24H20N2O4S/c1-12-20-17(11-16-21(20)24(16,2)3)26(25-12)23(28)13-8-9-15-19(10-13)31(29,30)18-7-5-4-6-14(18)22(15)27/h4-10,16,21H,11H2,1-3H3/t16-,21+/m0/s1 |
| InChIKey | FQAZSDGOMZMZSF-HRAATJIYSA-N |
| XLogP | 3.55 |
| TPSA | 86.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |