C22H26O6 — CID 124536785
(9S,11R,12R,14S)-9,11,12,14-tetraacetyltricyclo[6.3.3.01,8]tetradec-4-ene-10,13-dione (PubChem CID 124536785) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is (9S,11R,12R,14S)-9,11,12,14-tetraacetyltricyclo[6.3.3.01,8]tetradec-4-ene-10,13-dione.
| Compound Name | (9S,11R,12R,14S)-9,11,12,14-tetraacetyltricyclo[6.3.3.01,8]tetradec-4-ene-10,13-dione |
|---|---|
| PubChem CID | 124536785 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (9S,11R,12R,14S)-9,11,12,14-tetraacetyltricyclo[6.3.3.01,8]tetradec-4-ene-10,13-dione |
| SMILES | CC(=O)[C@@H]1C(=O)[C@H](C(C)=O)C23CCC=CCCC12[C@H](C(C)=O)C(=O)[C@@H]3C(C)=O |
| InChI | InChI=1S/C22H26O6/c1-11(23)15-19(27)16(12(2)24)22-10-8-6-5-7-9-21(15,22)17(13(3)25)20(28)18(22)14(4)26/h5-6,15-18H,7-10H2,1-4H3/t15-,16+,17-,18+,21?,22? |
| InChIKey | CHAWFIIGGKYFMF-SHFBKJGYSA-N |
| XLogP | 2.08 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|