C24H18Br2O3 — CID 124536807
(11S,12R,16R,17S)-5,23-dibromo-14-oxahexacyclo[15.8.0.02,11.03,8.012,16.020,25]pentacosa-1,3(8),4,6,20(25),21,23-heptaene-13,15-dione (PubChem CID 124536807) has the molecular formula C24H18Br2O3 and a molecular weight of 514.21 g/mol. Its IUPAC name is (11S,12R,16R,17S)-5,23-dibromo-14-oxahexacyclo[15.8.0.02,11.03,8.012,16.020,25]pentacosa-1,3(8),4,6,20(25),21,23-heptaene-13,15-dione.
| Compound Name | (11S,12R,16R,17S)-5,23-dibromo-14-oxahexacyclo[15.8.0.02,11.03,8.012,16.020,25]pentacosa-1,3(8),4,6,20(25),21,23-heptaene-13,15-dione |
|---|---|
| PubChem CID | 124536807 |
| Molecular Formula | C24H18Br2O3 |
| Molecular Weight | 514.21 g/mol |
| Exact Mass | 511.96 |
| IUPAC Name | (11S,12R,16R,17S)-5,23-dibromo-14-oxahexacyclo[15.8.0.02,11.03,8.012,16.020,25]pentacosa-1,3(8),4,6,20(25),21,23-heptaene-13,15-dione |
| SMILES | O=C1OC(=O)[C@H]2[C@H]1[C@@H]1CCc3ccc(Br)cc3C1=C1c3cc(Br)ccc3CC[C@H]12 |
| InChI | InChI=1S/C24H18Br2O3/c25-13-5-1-11-3-7-15-19(17(11)9-13)20-16(22-21(15)23(27)29-24(22)28)8-4-12-2-6-14(26)10-18(12)20/h1-2,5-6,9-10,15-16,21-22H,3-4,7-8H2/t15-,16-,21-,22-/m1/s1 |
| InChIKey | UHPWIMGYLOOUOC-AHWCRGGASA-N |
| XLogP | 5.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.21 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|