C6H9F2NO — CID 124537402
(3aR,6aS)-3,3-difluoro-2,3a,4,5,6,6a-hexahydrofuro[2,3-c]pyrrole (PubChem CID 124537402) has the molecular formula C6H9F2NO and a molecular weight of 149.14 g/mol. Its IUPAC name is (3aR,6aS)-3,3-difluoro-2,3a,4,5,6,6a-hexahydrofuro[2,3-c]pyrrole.
| Compound Name | (3aR,6aS)-3,3-difluoro-2,3a,4,5,6,6a-hexahydrofuro[2,3-c]pyrrole |
|---|---|
| PubChem CID | 124537402 |
| Molecular Formula | C6H9F2NO |
| Molecular Weight | 149.14 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | (3aR,6aS)-3,3-difluoro-2,3a,4,5,6,6a-hexahydrofuro[2,3-c]pyrrole |
| SMILES | FC1(F)CO[C@@H]2CNC[C@H]21 |
| InChI | InChI=1S/C6H9F2NO/c7-6(8)3-10-5-2-9-1-4(5)6/h4-5,9H,1-3H2/t4-,5-/m1/s1 |
| InChIKey | HXBCFQYRLNCEOF-RFZPGFLSSA-N |
| XLogP | 0.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.14 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |