C9H20N2 — CID 124537537
[(1S,6R)-2,2,6-trimethylcyclohexyl]hydrazine (PubChem CID 124537537) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is [(1S,6R)-2,2,6-trimethylcyclohexyl]hydrazine.
| Compound Name | [(1S,6R)-2,2,6-trimethylcyclohexyl]hydrazine |
|---|---|
| PubChem CID | 124537537 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | [(1S,6R)-2,2,6-trimethylcyclohexyl]hydrazine |
| SMILES | C[C@@H]1CCCC(C)(C)[C@H]1NN |
| InChI | InChI=1S/C9H20N2/c1-7-5-4-6-9(2,3)8(7)11-10/h7-8,11H,4-6,10H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | VIIANFRUNPUDKC-SFYZADRCSA-N |
| XLogP | 1.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|