C26H24BrClN2O3S — CID 124538312
(3aR,4S,9bS)-4-(5-bromo-2-methoxyphenyl)-N-(4-chloro-2-methylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 124538312) has the molecular formula C26H24BrClN2O3S and a molecular weight of 559.91 g/mol. Its IUPAC name is (3aR,4S,9bS)-4-(5-bromo-2-methoxyphenyl)-N-(4-chloro-2-methylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | (3aR,4S,9bS)-4-(5-bromo-2-methoxyphenyl)-N-(4-chloro-2-methylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 124538312 |
| Molecular Formula | C26H24BrClN2O3S |
| Molecular Weight | 559.91 g/mol |
| Exact Mass | 558.04 |
| IUPAC Name | (3aR,4S,9bS)-4-(5-bromo-2-methoxyphenyl)-N-(4-chloro-2-methylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | COc1ccc(Br)cc1[C@H]1Nc2ccc(S(=O)(=O)Nc3ccc(Cl)cc3C)cc2[C@H]2C=CC[C@H]21 |
| InChI | InChI=1S/C26H24BrClN2O3S/c1-15-12-17(28)7-9-23(15)30-34(31,32)18-8-10-24-21(14-18)19-4-3-5-20(19)26(29-24)22-13-16(27)6-11-25(22)33-2/h3-4,6-14,19-20,26,29-30H,5H2,1-2H3/t19-,20+,26-/m0/s1 |
| InChIKey | HKWDZOKFCCLXAO-UNVFRBQDSA-N |
| XLogP | 7.05 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.91 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|