C29H23BrN2O2S — CID 124539280
(11R,14E)-14-[(3-bromo-4-ethoxyphenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124539280) has the molecular formula C29H23BrN2O2S and a molecular weight of 543.49 g/mol. Its IUPAC name is (11R,14E)-14-[(3-bromo-4-ethoxyphenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11R,14E)-14-[(3-bromo-4-ethoxyphenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124539280 |
| Molecular Formula | C29H23BrN2O2S |
| Molecular Weight | 543.49 g/mol |
| Exact Mass | 542.07 |
| IUPAC Name | (11R,14E)-14-[(3-bromo-4-ethoxyphenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | CCOc1ccc(/C=c2/sc3n(c2=O)[C@H](c2ccccc2)C2=C(N=3)c3ccccc3CC2)cc1Br |
| InChI | InChI=1S/C29H23BrN2O2S/c1-2-34-24-15-12-18(16-23(24)30)17-25-28(33)32-27(20-9-4-3-5-10-20)22-14-13-19-8-6-7-11-21(19)26(22)31-29(32)35-25/h3-12,15-17,27H,2,13-14H2,1H3/b25-17+/t27-/m1/s1 |
| InChIKey | JEJQXKOCOWTAJH-ABBNRAPFSA-N |
| XLogP | 5.48 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |