C32H26BrNO4 — CID 124539354
3-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione (PubChem CID 124539354) has the molecular formula C32H26BrNO4 and a molecular weight of 568.47 g/mol. Its IUPAC name is 3-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione.
| Compound Name | 3-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 124539354 |
| Molecular Formula | C32H26BrNO4 |
| Molecular Weight | 568.47 g/mol |
| Exact Mass | 567.10 |
| IUPAC Name | 3-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione |
| SMILES | O=C1OC2(CCCCC2)OC(=O)C1=Cc1cc(-c2ccccc2)n(-c2ccc(Br)cc2)c1-c1ccccc1 |
| InChI | InChI=1S/C32H26BrNO4/c33-25-14-16-26(17-15-25)34-28(22-10-4-1-5-11-22)21-24(29(34)23-12-6-2-7-13-23)20-27-30(35)37-32(38-31(27)36)18-8-3-9-19-32/h1-2,4-7,10-17,20-21H,3,8-9,18-19H2 |
| InChIKey | COCSKZCEVJSNDR-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.47 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|