C19H11Cl2F3N4O4 — CID 124541875
2,4-dichloro-N-[(Z)-[(5R)-2,4,6-trioxo-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-yl]methylideneamino]benzamide (PubChem CID 124541875) has the molecular formula C19H11Cl2F3N4O4 and a molecular weight of 487.22 g/mol. Its IUPAC name is 2,4-dichloro-N-[(Z)-[(5R)-2,4,6-trioxo-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-yl]methylideneamino]benzamide.
| Compound Name | 2,4-dichloro-N-[(Z)-[(5R)-2,4,6-trioxo-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 124541875 |
| Molecular Formula | C19H11Cl2F3N4O4 |
| Molecular Weight | 487.22 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | 2,4-dichloro-N-[(Z)-[(5R)-2,4,6-trioxo-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C\[C@@H]1C(=O)NC(=O)N(c2cccc(C(F)(F)F)c2)C1=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H11Cl2F3N4O4/c20-10-4-5-12(14(21)7-10)16(30)27-25-8-13-15(29)26-18(32)28(17(13)31)11-3-1-2-9(6-11)19(22,23)24/h1-8,13H,(H,27,30)(H,26,29,32)/b25-8-/t13-/m1/s1 |
| InChIKey | LMZWDCKBXNZIFK-HXLKOSTRSA-N |
| XLogP | 3.63 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.22 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|