C26H24BrN3O3S — CID 124542227
3-bromo-N-[[4-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-4-methoxybenzamide (PubChem CID 124542227) has the molecular formula C26H24BrN3O3S and a molecular weight of 538.47 g/mol. Its IUPAC name is 3-bromo-N-[[4-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-4-methoxybenzamide.
| Compound Name | 3-bromo-N-[[4-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 124542227 |
| Molecular Formula | C26H24BrN3O3S |
| Molecular Weight | 538.47 g/mol |
| Exact Mass | 537.07 |
| IUPAC Name | 3-bromo-N-[[4-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-4-methoxybenzamide |
| SMILES | CC[C@@H](C)c1ccc2oc(-c3ccc(NC(=S)NC(=O)c4ccc(OC)c(Br)c4)cc3)nc2c1 |
| InChI | InChI=1S/C26H24BrN3O3S/c1-4-15(2)17-7-12-23-21(14-17)29-25(33-23)16-5-9-19(10-6-16)28-26(34)30-24(31)18-8-11-22(32-3)20(27)13-18/h5-15H,4H2,1-3H3,(H2,28,30,31,34)/t15-/m1/s1 |
| InChIKey | ULBYKDDIAUXFHL-OAHLLOKOSA-N |
| XLogP | 6.91 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.47 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|