C28H21N3O4 — CID 124544022
(1R,2S)-5,7-dimethyl-2-(4-phenoxyphenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),9,11,13,15-pentaene-4,6,17-trione (PubChem CID 124544022) has the molecular formula C28H21N3O4 and a molecular weight of 463.49 g/mol. Its IUPAC name is (1R,2S)-5,7-dimethyl-2-(4-phenoxyphenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),9,11,13,15-pentaene-4,6,17-trione.
| Compound Name | (1R,2S)-5,7-dimethyl-2-(4-phenoxyphenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),9,11,13,15-pentaene-4,6,17-trione |
|---|---|
| PubChem CID | 124544022 |
| Molecular Formula | C28H21N3O4 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | (1R,2S)-5,7-dimethyl-2-(4-phenoxyphenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),9,11,13,15-pentaene-4,6,17-trione |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)[C@H](c1ccc(Oc3ccccc3)cc1)[C@H]1C(=O)c3ccccc3C1=N2 |
| InChI | InChI=1S/C28H21N3O4/c1-30-26-23(27(33)31(2)28(30)34)21(22-24(29-26)19-10-6-7-11-20(19)25(22)32)16-12-14-18(15-13-16)35-17-8-4-3-5-9-17/h3-15,21-22H,1-2H3/t21-,22-/m1/s1 |
| InChIKey | OLFPVKJVIUKJQY-FGZHOGPDSA-N |
| XLogP | 3.96 |
| TPSA | 82.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |