C18H12Cl4N8S — CID 124544078
2-N,4-N-bis(2,4-dichlorophenyl)-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3,5-triazine-2,4-diamine (PubChem CID 124544078) has the molecular formula C18H12Cl4N8S and a molecular weight of 514.23 g/mol. Its IUPAC name is 2-N,4-N-bis(2,4-dichlorophenyl)-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(2,4-dichlorophenyl)-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 124544078 |
| Molecular Formula | C18H12Cl4N8S |
| Molecular Weight | 514.23 g/mol |
| Exact Mass | 511.97 |
| IUPAC Name | 2-N,4-N-bis(2,4-dichlorophenyl)-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Cn1cnnc1Sc1nc(Nc2ccc(Cl)cc2Cl)nc(Nc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C18H12Cl4N8S/c1-30-8-23-29-18(30)31-17-27-15(24-13-4-2-9(19)6-11(13)21)26-16(28-17)25-14-5-3-10(20)7-12(14)22/h2-8H,1H3,(H2,24,25,26,27,28) |
| InChIKey | HNLWVFZQNBHEAV-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.23 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |