C29H27ClN2O3S2 — CID 124544509
2-[benzyl-(4-methylphenyl)sulfonylamino]-N-[2-(4-chlorophenyl)sulfanylethyl]benzamide (PubChem CID 124544509) has the molecular formula C29H27ClN2O3S2 and a molecular weight of 551.13 g/mol. Its IUPAC name is 2-[benzyl-(4-methylphenyl)sulfonylamino]-N-[2-(4-chlorophenyl)sulfanylethyl]benzamide.
| Compound Name | 2-[benzyl-(4-methylphenyl)sulfonylamino]-N-[2-(4-chlorophenyl)sulfanylethyl]benzamide |
|---|---|
| PubChem CID | 124544509 |
| Molecular Formula | C29H27ClN2O3S2 |
| Molecular Weight | 551.13 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | 2-[benzyl-(4-methylphenyl)sulfonylamino]-N-[2-(4-chlorophenyl)sulfanylethyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccccc2)c2ccccc2C(=O)NCCSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C29H27ClN2O3S2/c1-22-11-17-26(18-12-22)37(34,35)32(21-23-7-3-2-4-8-23)28-10-6-5-9-27(28)29(33)31-19-20-36-25-15-13-24(30)14-16-25/h2-18H,19-21H2,1H3,(H,31,33) |
| InChIKey | RJQLUEGENOYCKN-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.13 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|