C16H19F2N3O2 — CID 124545101
(2R)-4-[[2-(difluoromethoxy)phenyl]methyl]-2-(pyrazol-1-ylmethyl)morpholine (PubChem CID 124545101) has the molecular formula C16H19F2N3O2 and a molecular weight of 323.34 g/mol. Its IUPAC name is (2R)-4-[[2-(difluoromethoxy)phenyl]methyl]-2-(pyrazol-1-ylmethyl)morpholine.
| Compound Name | (2R)-4-[[2-(difluoromethoxy)phenyl]methyl]-2-(pyrazol-1-ylmethyl)morpholine |
|---|---|
| PubChem CID | 124545101 |
| Molecular Formula | C16H19F2N3O2 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (2R)-4-[[2-(difluoromethoxy)phenyl]methyl]-2-(pyrazol-1-ylmethyl)morpholine |
| SMILES | FC(F)Oc1ccccc1CN1CCO[C@@H](Cn2cccn2)C1 |
| InChI | InChI=1S/C16H19F2N3O2/c17-16(18)23-15-5-2-1-4-13(15)10-20-8-9-22-14(11-20)12-21-7-3-6-19-21/h1-7,14,16H,8-12H2/t14-/m1/s1 |
| InChIKey | XGYZDJAQJXOUKM-CQSZACIVSA-N |
| XLogP | 2.39 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |