C21H19ClFNO3S — CID 124546401
(5Z)-5-[[4-[(2S)-butan-2-yl]oxyphenyl]methylidene]-3-[(2-chloro-4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 124546401) has the molecular formula C21H19ClFNO3S and a molecular weight of 419.91 g/mol. Its IUPAC name is (5Z)-5-[[4-[(2S)-butan-2-yl]oxyphenyl]methylidene]-3-[(2-chloro-4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[(2S)-butan-2-yl]oxyphenyl]methylidene]-3-[(2-chloro-4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124546401 |
| Molecular Formula | C21H19ClFNO3S |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | (5Z)-5-[[4-[(2S)-butan-2-yl]oxyphenyl]methylidene]-3-[(2-chloro-4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC[C@H](C)Oc1ccc(/C=C2\SC(=O)N(Cc3ccc(F)cc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C21H19ClFNO3S/c1-3-13(2)27-17-8-4-14(5-9-17)10-19-20(25)24(21(26)28-19)12-15-6-7-16(23)11-18(15)22/h4-11,13H,3,12H2,1-2H3/b19-10-/t13-/m0/s1 |
| InChIKey | SDSZJARSKWQJGO-GJUHEBOISA-N |
| XLogP | 5.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|