C19H18N2O6S — CID 124553998
(1S,2S,5S)-2-[3-[(1S,2R,5S)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]-2-sulfanylidenebenzimidazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 124553998) has the molecular formula C19H18N2O6S and a molecular weight of 402.43 g/mol. Its IUPAC name is (1S,2S,5S)-2-[3-[(1S,2R,5S)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]-2-sulfanylidenebenzimidazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | (1S,2S,5S)-2-[3-[(1S,2R,5S)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]-2-sulfanylidenebenzimidazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 124553998 |
| Molecular Formula | C19H18N2O6S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | (1S,2S,5S)-2-[3-[(1S,2R,5S)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]-2-sulfanylidenebenzimidazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | O=C1C[C@@H](n2c(=S)n([C@H]3CC(=O)[C@H]4OC[C@H]3O4)c3ccccc32)[C@H]2CO[C@H]1O2 |
| InChI | InChI=1S/C19H18N2O6S/c22-13-5-11(15-7-24-17(13)26-15)20-9-3-1-2-4-10(9)21(19(20)28)12-6-14(23)18-25-8-16(12)27-18/h1-4,11-12,15-18H,5-8H2/t11-,12+,15-,16-,17+,18+/m1/s1 |
| InChIKey | RQGIDQQMSDJKIJ-AJBGNORXSA-N |
| XLogP | 1.68 |
| TPSA | 80.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|