C25H30N6O5S2 — CID 124554658
N-[(1S)-1-[4-ethyl-5-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-3-methylsulfanylpropyl]-4-methoxybenzamide (PubChem CID 124554658) has the molecular formula C25H30N6O5S2 and a molecular weight of 558.69 g/mol. Its IUPAC name is N-[(1S)-1-[4-ethyl-5-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-3-methylsulfanylpropyl]-4-methoxybenzamide.
| Compound Name | N-[(1S)-1-[4-ethyl-5-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-3-methylsulfanylpropyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 124554658 |
| Molecular Formula | C25H30N6O5S2 |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | N-[(1S)-1-[4-ethyl-5-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-3-methylsulfanylpropyl]-4-methoxybenzamide |
| SMILES | CCn1c(SCC(=O)Nc2ccc([N+](=O)[O-])cc2C)nnc1[C@H](CCSC)NC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H30N6O5S2/c1-5-30-23(21(12-13-37-4)27-24(33)17-6-9-19(36-3)10-7-17)28-29-25(30)38-15-22(32)26-20-11-8-18(31(34)35)14-16(20)2/h6-11,14,21H,5,12-13,15H2,1-4H3,(H,26,32)(H,27,33)/t21-/m0/s1 |
| InChIKey | BOOYBJSKSRFJJG-NRFANRHFSA-N |
| XLogP | 4.48 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|