C18H24N2O3 — CID 124555777
1-[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]-N-[(5-methoxy-1-benzofuran-2-yl)methyl]methanamine (PubChem CID 124555777) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]-N-[(5-methoxy-1-benzofuran-2-yl)methyl]methanamine.
| Compound Name | 1-[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]-N-[(5-methoxy-1-benzofuran-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 124555777 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]-N-[(5-methoxy-1-benzofuran-2-yl)methyl]methanamine |
| SMILES | COc1ccc2oc(CNC[C@@H]3CN4CCC[C@H]4CO3)cc2c1 |
| InChI | InChI=1S/C18H24N2O3/c1-21-15-4-5-18-13(7-15)8-16(23-18)9-19-10-17-11-20-6-2-3-14(20)12-22-17/h4-5,7-8,14,17,19H,2-3,6,9-12H2,1H3/t14-,17+/m0/s1 |
| InChIKey | LMXCSVHOAPXFTI-WMLDXEAASA-N |
| XLogP | 2.39 |
| TPSA | 46.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |