C18H15N3OS — CID 1245561
(2R)-2-phenyl-2-phenylsulfanyl-N-pyrazin-2-ylacetamide (PubChem CID 1245561) has the molecular formula C18H15N3OS and a molecular weight of 321.41 g/mol. Its IUPAC name is (2R)-2-phenyl-2-phenylsulfanyl-N-pyrazin-2-ylacetamide.
| Compound Name | (2R)-2-phenyl-2-phenylsulfanyl-N-pyrazin-2-ylacetamide |
|---|---|
| PubChem CID | 1245561 |
| Molecular Formula | C18H15N3OS |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | (2R)-2-phenyl-2-phenylsulfanyl-N-pyrazin-2-ylacetamide |
| SMILES | O=C(Nc1cnccn1)[C@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H15N3OS/c22-18(21-16-13-19-11-12-20-16)17(14-7-3-1-4-8-14)23-15-9-5-2-6-10-15/h1-13,17H,(H,20,21,22)/t17-/m1/s1 |
| InChIKey | YTQBJVRVZCJTNE-QGZVFWFLSA-N |
| XLogP | 3.95 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |