C13H20ClNO2S — CID 124559501
(2S)-N-[(2-chlorophenyl)methyl]-N-ethyl-1-methylsulfonylpropan-2-amine (PubChem CID 124559501) has the molecular formula C13H20ClNO2S and a molecular weight of 289.83 g/mol. Its IUPAC name is (2S)-N-[(2-chlorophenyl)methyl]-N-ethyl-1-methylsulfonylpropan-2-amine.
| Compound Name | (2S)-N-[(2-chlorophenyl)methyl]-N-ethyl-1-methylsulfonylpropan-2-amine |
|---|---|
| PubChem CID | 124559501 |
| Molecular Formula | C13H20ClNO2S |
| Molecular Weight | 289.83 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | (2S)-N-[(2-chlorophenyl)methyl]-N-ethyl-1-methylsulfonylpropan-2-amine |
| SMILES | CCN(Cc1ccccc1Cl)[C@@H](C)CS(C)(=O)=O |
| InChI | InChI=1S/C13H20ClNO2S/c1-4-15(11(2)10-18(3,16)17)9-12-7-5-6-8-13(12)14/h5-8,11H,4,9-10H2,1-3H3/t11-/m0/s1 |
| InChIKey | WRNYJNGODPEUPE-NSHDSACASA-N |
| XLogP | 2.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.83 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |