About methyl 2-[(3-cyclopentyl-2,5-dioxoimidazolidin-1-yl)methyl]-5-fluorobenzoate
methyl 2-[(3-cyclopentyl-2,5-dioxoimidazolidin-1-yl)methyl]-5-fluorobenzoate (PubChem CID 124559726) has the molecular formula C17H19FN2O4
and a molecular weight of 334.35 g/mol. Its IUPAC name is methyl 2-[(3-cyclopentyl-2,5-dioxoimidazolidin-1-yl)methyl]-5-fluorobenzoate.
Molecular Properties
| Compound Name | methyl 2-[(3-cyclopentyl-2,5-dioxoimidazolidin-1-yl)methyl]-5-fluorobenzoate |
| PubChem CID | 124559726 |
| Molecular Formula | C17H19FN2O4 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | methyl 2-[(3-cyclopentyl-2,5-dioxoimidazolidin-1-yl)methyl]-5-fluorobenzoate |
| SMILES | COC(=O)c1cc(F)ccc1CN1C(=O)CN(C2CCCC2)C1=O |
| InChI | InChI=1S/C17H19FN2O4/c1-24-16(22)14-8-12(18)7-6-11(14)9-20-15(21)10-19(17(20)23)13-4-2-3-5-13/h6-8,13H,2-5,9-10H2,1H3 |
| InChIKey | GPUMXHUDJFGVQE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(3-cyclopentyl-2,5-dioxoimidazolidin-1-yl)methyl]-5-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3-cyclopentyl-2,5-dioxoimidazolidin-1-yl)methyl]-5-fluorobenzoate?
The IUPAC name of methyl 2-[(3-cyclopentyl-2,5-dioxoimidazolidin-1-yl)methyl]-5-fluorobenzoate (CID 124559726) is methyl 2-[(3-cyclopentyl-2,5-dioxoimidazolidin-1-yl)methyl]-5-fluorobenzoate.
What is the SMILES notation for methyl 2-[(3-cyclopentyl-2,5-dioxoimidazolidin-1-yl)methyl]-5-fluorobenzoate?
The canonical SMILES for methyl 2-[(3-cyclopentyl-2,5-dioxoimidazolidin-1-yl)methyl]-5-fluorobenzoate is COC(=O)c1cc(F)ccc1CN1C(=O)CN(C2CCCC2)C1=O.
What is the InChIKey of methyl 2-[(3-cyclopentyl-2,5-dioxoimidazolidin-1-yl)methyl]-5-fluorobenzoate?
The InChIKey is GPUMXHUDJFGVQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19FN2O4/c1-24-16(22)14-8-12(18)7-6-11(14)9-20-15(21)10-19(17(20)23)13-4-2-3-5-13/h6-8,13H,2-5,9-10H2,1H3.
What are the key properties of methyl 2-[(3-cyclopentyl-2,5-dioxoimidazolidin-1-yl)methyl]-5-fluorobenzoate?
methyl 2-[(3-cyclopentyl-2,5-dioxoimidazolidin-1-yl)methyl]-5-fluorobenzoate has a molecular weight of 334.35 g/mol, XLogP of 2.32, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3-cyclopentyl-2,5-dioxoimidazolidin-1-yl)methyl]-5-fluorobenzoate is sourced from PubChem (CID 124559726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).