C10H10Cl2N4O — CID 124560527
2,6-dichloro-9-[[(3R)-oxolan-3-yl]methyl]purine (PubChem CID 124560527) has the molecular formula C10H10Cl2N4O and a molecular weight of 273.12 g/mol. Its IUPAC name is 2,6-dichloro-9-[[(3R)-oxolan-3-yl]methyl]purine.
| Compound Name | 2,6-dichloro-9-[[(3R)-oxolan-3-yl]methyl]purine |
|---|---|
| PubChem CID | 124560527 |
| Molecular Formula | C10H10Cl2N4O |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 2,6-dichloro-9-[[(3R)-oxolan-3-yl]methyl]purine |
| SMILES | Clc1nc(Cl)c2ncn(C[C@H]3CCOC3)c2n1 |
| InChI | InChI=1S/C10H10Cl2N4O/c11-8-7-9(15-10(12)14-8)16(5-13-7)3-6-1-2-17-4-6/h5-6H,1-4H2/t6-/m1/s1 |
| InChIKey | CNESPYAXZDEWJM-ZCFIWIBFSA-N |
| XLogP | 2.17 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |