C13H16N2O — CID 124562129
(1R)-1-(2,6-dimethylphenyl)-1-(1H-imidazol-2-yl)ethanol (PubChem CID 124562129) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is (1R)-1-(2,6-dimethylphenyl)-1-(1H-imidazol-2-yl)ethanol.
| Compound Name | (1R)-1-(2,6-dimethylphenyl)-1-(1H-imidazol-2-yl)ethanol |
|---|---|
| PubChem CID | 124562129 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (1R)-1-(2,6-dimethylphenyl)-1-(1H-imidazol-2-yl)ethanol |
| SMILES | Cc1cccc(C)c1[C@@](C)(O)c1ncc[nH]1 |
| InChI | InChI=1S/C13H16N2O/c1-9-5-4-6-10(2)11(9)13(3,16)12-14-7-8-15-12/h4-8,16H,1-3H3,(H,14,15)/t13-/m1/s1 |
| InChIKey | FZTAHGKGKHILAT-CYBMUJFWSA-N |
| XLogP | 2.28 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |