(1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-4-carboxylic acid

C12H12O2 — CID 124564050

IUPAC(1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-4-carboxylic acid
SMILESO=C(O)c1ccc2c(c1)[C@H]1CC[C@H]2C1
InChIInChI=1S/C12H12O2/c13-12(14)9-3-4-10-7-1-2-8(5-7)11(10)6-9/h3-4,6-8H,1-2,5H2,(H,13,14)/t7-,8-/m0/s1
InChIKeyCYVBQJNJHBYVJW-YUMQZZPRSA-N
MW188.23 g/mol
LogP2.75
Rot. Bonds1

About (1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-4-carboxylic acid

(1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-4-carboxylic acid (PubChem CID 124564050) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is (1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-4-carboxylic acid.

Molecular Properties

Compound Name(1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-4-carboxylic acid
PubChem CID124564050
Molecular FormulaC12H12O2
Molecular Weight188.23 g/mol
Exact Mass188.08
IUPAC Name(1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-4-carboxylic acid
SMILESO=C(O)c1ccc2c(c1)[C@H]1CC[C@H]2C1
InChIInChI=1S/C12H12O2/c13-12(14)9-3-4-10-7-1-2-8(5-7)11(10)6-9/h3-4,6-8H,1-2,5H2,(H,13,14)/t7-,8-/m0/s1
InChIKeyCYVBQJNJHBYVJW-YUMQZZPRSA-N
XLogP2.75
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.23
LogP ≤ 52.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-4-carboxylic acid?
The IUPAC name of (1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-4-carboxylic acid (CID 124564050) is (1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-4-carboxylic acid.
What is the SMILES notation for (1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-4-carboxylic acid?
The canonical SMILES for (1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-4-carboxylic acid is O=C(O)c1ccc2c(c1)[C@H]1CC[C@H]2C1.
What is the InChIKey of (1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-4-carboxylic acid?
The InChIKey is CYVBQJNJHBYVJW-YUMQZZPRSA-N. The full InChI is InChI=1S/C12H12O2/c13-12(14)9-3-4-10-7-1-2-8(5-7)11(10)6-9/h3-4,6-8H,1-2,5H2,(H,13,14)/t7-,8-/m0/s1.
What are the key properties of (1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-4-carboxylic acid?
(1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-4-carboxylic acid has a molecular weight of 188.23 g/mol, XLogP of 2.75, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-4-carboxylic acid is sourced from PubChem (CID 124564050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).