C13H18FN — CID 124565703
(1S,2R)-5-tert-butyl-2-fluoro-2,3-dihydro-1H-inden-1-amine (PubChem CID 124565703) has the molecular formula C13H18FN and a molecular weight of 207.29 g/mol. Its IUPAC name is (1S,2R)-5-tert-butyl-2-fluoro-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1S,2R)-5-tert-butyl-2-fluoro-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 124565703 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | (1S,2R)-5-tert-butyl-2-fluoro-2,3-dihydro-1H-inden-1-amine |
| SMILES | CC(C)(C)c1ccc2c(c1)C[C@@H](F)[C@H]2N |
| InChI | InChI=1S/C13H18FN/c1-13(2,3)9-4-5-10-8(6-9)7-11(14)12(10)15/h4-6,11-12H,7,15H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | NVXCKNSCWANVFB-NEPJUHHUSA-N |
| XLogP | 2.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |