About N-(cyclohexylmethyl)-4,5-dimethylthiophene-3-carboxamide
N-(cyclohexylmethyl)-4,5-dimethylthiophene-3-carboxamide (PubChem CID 1245661) has the molecular formula C14H21NOS
and a molecular weight of 251.39 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-4,5-dimethylthiophene-3-carboxamide.
Molecular Properties
| Compound Name | N-(cyclohexylmethyl)-4,5-dimethylthiophene-3-carboxamide |
| PubChem CID | 1245661 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N-(cyclohexylmethyl)-4,5-dimethylthiophene-3-carboxamide |
| SMILES | Cc1scc(C(=O)NCC2CCCCC2)c1C |
| InChI | InChI=1S/C14H21NOS/c1-10-11(2)17-9-13(10)14(16)15-8-12-6-4-3-5-7-12/h9,12H,3-8H2,1-2H3,(H,15,16) |
| InChIKey | RFBPKLGKAXQGSA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(cyclohexylmethyl)-4,5-dimethylthiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexylmethyl)-4,5-dimethylthiophene-3-carboxamide?
The IUPAC name of N-(cyclohexylmethyl)-4,5-dimethylthiophene-3-carboxamide (CID 1245661) is N-(cyclohexylmethyl)-4,5-dimethylthiophene-3-carboxamide.
What is the SMILES notation for N-(cyclohexylmethyl)-4,5-dimethylthiophene-3-carboxamide?
The canonical SMILES for N-(cyclohexylmethyl)-4,5-dimethylthiophene-3-carboxamide is Cc1scc(C(=O)NCC2CCCCC2)c1C.
What is the InChIKey of N-(cyclohexylmethyl)-4,5-dimethylthiophene-3-carboxamide?
The InChIKey is RFBPKLGKAXQGSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NOS/c1-10-11(2)17-9-13(10)14(16)15-8-12-6-4-3-5-7-12/h9,12H,3-8H2,1-2H3,(H,15,16).
What are the key properties of N-(cyclohexylmethyl)-4,5-dimethylthiophene-3-carboxamide?
N-(cyclohexylmethyl)-4,5-dimethylthiophene-3-carboxamide has a molecular weight of 251.39 g/mol, XLogP of 3.68, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexylmethyl)-4,5-dimethylthiophene-3-carboxamide is sourced from PubChem (CID 1245661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).