C16H16ClN3O2 — CID 124566233
5-chloro-N-[4-[(2S)-morpholin-2-yl]phenyl]pyridine-2-carboxamide (PubChem CID 124566233) has the molecular formula C16H16ClN3O2 and a molecular weight of 317.78 g/mol. Its IUPAC name is 5-chloro-N-[4-[(2S)-morpholin-2-yl]phenyl]pyridine-2-carboxamide.
| Compound Name | 5-chloro-N-[4-[(2S)-morpholin-2-yl]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 124566233 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 5-chloro-N-[4-[(2S)-morpholin-2-yl]phenyl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc([C@H]2CNCCO2)cc1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C16H16ClN3O2/c17-12-3-6-14(19-9-12)16(21)20-13-4-1-11(2-5-13)15-10-18-7-8-22-15/h1-6,9,15,18H,7-8,10H2,(H,20,21)/t15-/m1/s1 |
| InChIKey | ASRMZZJJYSITLY-OAHLLOKOSA-N |
| XLogP | 2.65 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |