C15H11Cl3O4 — CID 124566804
(2R)-2-[5-chloro-2-(2,4-dichlorophenoxy)phenoxy]propanoic acid (PubChem CID 124566804) has the molecular formula C15H11Cl3O4 and a molecular weight of 361.61 g/mol. Its IUPAC name is (2R)-2-[5-chloro-2-(2,4-dichlorophenoxy)phenoxy]propanoic acid.
| Compound Name | (2R)-2-[5-chloro-2-(2,4-dichlorophenoxy)phenoxy]propanoic acid |
|---|---|
| PubChem CID | 124566804 |
| Molecular Formula | C15H11Cl3O4 |
| Molecular Weight | 361.61 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | (2R)-2-[5-chloro-2-(2,4-dichlorophenoxy)phenoxy]propanoic acid |
| SMILES | C[C@@H](Oc1cc(Cl)ccc1Oc1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C15H11Cl3O4/c1-8(15(19)20)21-14-7-10(17)3-5-13(14)22-12-4-2-9(16)6-11(12)18/h2-8H,1H3,(H,19,20)/t8-/m1/s1 |
| InChIKey | IQMQCXUUGKFKPR-MRVPVSSYSA-N |
| XLogP | 5.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.61 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |