C10H10F5NS — CID 124566857
5-[(1R)-1-methylsulfanylethyl]-2-(1,1,2,2,2-pentafluoroethyl)pyridine (PubChem CID 124566857) has the molecular formula C10H10F5NS and a molecular weight of 271.25 g/mol. Its IUPAC name is 5-[(1R)-1-methylsulfanylethyl]-2-(1,1,2,2,2-pentafluoroethyl)pyridine.
| Compound Name | 5-[(1R)-1-methylsulfanylethyl]-2-(1,1,2,2,2-pentafluoroethyl)pyridine |
|---|---|
| PubChem CID | 124566857 |
| Molecular Formula | C10H10F5NS |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 5-[(1R)-1-methylsulfanylethyl]-2-(1,1,2,2,2-pentafluoroethyl)pyridine |
| SMILES | CS[C@H](C)c1ccc(C(F)(F)C(F)(F)F)nc1 |
| InChI | InChI=1S/C10H10F5NS/c1-6(17-2)7-3-4-8(16-5-7)9(11,12)10(13,14)15/h3-6H,1-2H3/t6-/m1/s1 |
| InChIKey | YIPCQPVZPCZJAV-ZCFIWIBFSA-N |
| XLogP | 4.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|